ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
Ürün Adı |
5-Nitrothiophene-2-carboxaldehyde |
ingilizce adı |
5-Nitrothiophene-2-carboxaldehyde;5-Nitrothiophene-2-carbaldehyde |
Moleküler Formülü |
C5H3NO3S |
Molekül Ağırlığı |
157.1472 |
InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
CAS kayıt numarası |
4521-33-9 |
EINECS |
224-850-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.534g/cm3 |
Kaynama noktası |
297.2°C at 760 mmHg |
Kırılma indisi |
1.662 |
Alevlenme noktası |
133.5°C |
Buhar basıncı |
0.00137mmHg at 25°C |
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|