ChemNet > CAS > 621-51-2 3-Ethoxybenzoic acid
621-51-2 3-Ethoxybenzoic acid
نام محصول |
3-Ethoxybenzoic acid |
مترادف |
3-Ethoxy Benzoic Acid |
میدان مغناطیسی |
C9H10O3 |
وزن مولکولی |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
شماره سیایاس |
621-51-2 |
تعداد کمیسیون اروپایی |
210-690-7 |
ساختار مولکولی |
|
تراکم |
1.166g/cm3 |
نقطه ذوب |
136-140℃ |
نقطه غلیان |
305.7°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
124.1°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|