ChemNet > CAS > 693-55-0 Ethyl hydrogen sebacate
693-55-0 Ethyl hydrogen sebacate
| نام محصول |
Ethyl hydrogen sebacate |
| مترادف |
Monoethyl sebacate~Sebacic acid monoethyl ester; monoethyl sebacate; Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester; 10-ethoxy-10-oxodecanoic acid |
| میدان مغناطیسی |
C12H22O4 |
| وزن مولکولی |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
| شماره سیایاس |
693-55-0 |
| تعداد کمیسیون اروپایی |
211-753-1 |
| ساختار مولکولی |
|
| تراکم |
1.024g/cm3 |
| نقطه غلیان |
336°C at 760 mmHg |
| ضریب شکست |
1.455 |
| نقطه اشتعال |
119°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
