693-55-0 Ethyl hydrogen sebacate
Nome del prodotto |
Ethyl hydrogen sebacate |
Nome inglese |
Ethyl hydrogen sebacate; Monoethyl sebacate~Sebacic acid monoethyl ester; monoethyl sebacate; Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester; 10-ethoxy-10-oxodecanoic acid |
Formula molecolare |
C12H22O4 |
Peso Molecolare |
230.3007 |
InChI |
InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
Numero CAS |
693-55-0 |
EINECS |
211-753-1 |
Struttura molecolare |
|
Densità |
1.024g/cm3 |
Punto di ebollizione |
336°C at 760 mmHg |
Indice di rifrazione |
1.455 |
Punto d'infiammabilità |
119°C |
Pressione di vapore |
2.17E-05mmHg at 25°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|