ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
نام محصول |
2,4-Dichlorophenethylalcohol |
نام انگلیسی |
2,4-Dichlorophenethylalcohol; 2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
میدان مغناطیسی |
C8H8Cl2O |
وزن مولکولی |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
شماره سیایاس |
81156-68-5 |
ساختار مولکولی |
|
تراکم |
1.329g/cm3 |
نقطه غلیان |
276.6°C at 760 mmHg |
ضریب شکست |
1.569 |
نقطه اشتعال |
117.2°C |
فشار بخار |
0.00229mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|