ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
اسم المنتج |
2,4-Dichlorophenethylalcohol |
الاسم بالانجليزية |
2,4-Dichlorophenethylalcohol; 2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
الصيغة الجزيئية |
C8H8Cl2O |
الوزن الجزيئي الغرامي |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
إستراتيجية المساعدة القطرية |
81156-68-5 |
بنية جزيئية |
|
كثافة |
1.329g/cm3 |
نقطة الغليان |
276.6°C at 760 mmHg |
معامل الإنكسار |
1.569 |
نقطة الوميض |
117.2°C |
ضغط البخار |
0.00229mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|