ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
| نام محصول |
4'-Hydroxy-2'-methylacetophenone |
| مترادف |
2'-Methyl-4'-hydroxyacetophenone |
| میدان مغناطیسی |
C9H10O2 |
| وزن مولکولی |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
| شماره سیایاس |
875-59-2 |
| تعداد کمیسیون اروپایی |
212-874-2 |
| ساختار مولکولی |
|
| تراکم |
1.106g/cm3 |
| نقطه ذوب |
127-132℃ |
| نقطه غلیان |
313°C at 760 mmHg |
| ضریب شکست |
1.546 |
| نقطه اشتعال |
127.9°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
