ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
نام محصول |
4'-Hydroxy-2'-methylacetophenone |
مترادف |
2'-Methyl-4'-hydroxyacetophenone |
میدان مغناطیسی |
C9H10O2 |
وزن مولکولی |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
شماره سیایاس |
875-59-2 |
تعداد کمیسیون اروپایی |
212-874-2 |
ساختار مولکولی |
|
تراکم |
1.106g/cm3 |
نقطه ذوب |
127-132℃ |
نقطه غلیان |
313°C at 760 mmHg |
ضریب شکست |
1.546 |
نقطه اشتعال |
127.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|