ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
Naam product |
4'-Hydroxy-2'-methylacetophenone |
Engelse naam |
4'-Hydroxy-2'-methylacetophenone; 2'-Methyl-4'-hydroxyacetophenone |
MF |
C9H10O2 |
Molecuulgewicht |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
CAS-nummer |
875-59-2 |
EINECS |
212-874-2 |
Moleculaire Structuur |
|
Dichtheid |
1.106g/cm3 |
Smeltpunt |
127-132℃ |
Kookpunt |
313°C at 760 mmHg |
Brekingsindex |
1.546 |
Vlampunt |
127.9°C |
Dampdruk |
0.000278mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|