ChemNet > CAS > 1119-46-6 5-Chlorovaleric acid
1119-46-6 5-Chlorovaleric acid
| Nome del prodotto |
5-Chlorovaleric acid |
| Sinonimi |
214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| Formula molecolare |
C5H9ClO2 |
| Peso Molecolare |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| Numero CAS |
1119-46-6 |
| EINECS |
214-279-3 |
| Struttura molecolare |
|
| Densità |
1.166g/cm3 |
| Punto di fusione |
18-20℃ |
| Punto di ebollizione |
230.9°C at 760 mmHg |
| Indice di rifrazione |
1.452 |
| Punto d'infiammabilità |
93.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
