1119-46-6 5-Chlorovaleric acid
اسم المنتج |
5-Chlorovaleric acid |
الاسم بالانجليزية |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
الصيغة الجزيئية |
C5H9ClO2 |
الوزن الجزيئي الغرامي |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
إستراتيجية المساعدة القطرية |
1119-46-6 |
المفوضية الأوروبية رقم |
214-279-3 |
بنية جزيئية |
|
كثافة |
1.166g/cm3 |
درجة الإنصهار |
18-20℃ |
نقطة الغليان |
230.9°C at 760 mmHg |
معامل الإنكسار |
1.452 |
نقطة الوميض |
93.4°C |
ضغط البخار |
0.0227mmHg at 25°C |
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|