491-78-1 Primuletin
| Nome del prodotto |
Primuletin |
| Nome inglese |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| Formula molecolare |
C15H10O3 |
| Peso Molecolare |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| Numero CAS |
491-78-1 |
| EINECS |
207-743-1 |
| Struttura molecolare |
|
| Densità |
1.34g/cm3 |
| Punto di ebollizione |
425°C at 760 mmHg |
| Indice di rifrazione |
1.666 |
| Punto d'infiammabilità |
165.4°C |
| Pressione di vapore |
7.97E-08mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|