ChemNet > CAS > 491-78-1 Primuletin
491-78-1 Primuletin
Naam product |
Primuletin |
Synoniemen |
5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
MF |
C15H10O3 |
Molecuulgewicht |
238.2381 |
InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
CAS-nummer |
491-78-1 |
EINECS |
207-743-1 |
Moleculaire Structuur |
|
Dichtheid |
1.34g/cm3 |
Kookpunt |
425°C at 760 mmHg |
Brekingsindex |
1.666 |
Vlampunt |
165.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|