5391-30-0 2-Bromophenylthiourea
Nome del prodotto |
2-Bromophenylthiourea |
Nome inglese |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
Formula molecolare |
C7H7BrN2S |
Peso Molecolare |
231.1129 |
InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
Numero CAS |
5391-30-0 |
Struttura molecolare |
|
Densità |
1.728g/cm3 |
Punto di ebollizione |
314.2°C at 760 mmHg |
Indice di rifrazione |
1.748 |
Punto d'infiammabilità |
143.8°C |
Pressione di vapore |
0.000474mmHg at 25°C |
Codici di Rischio |
R25:Toxic if swallowed.;
|
Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|