ChemNet > CAS > 5391-30-0 2-Bromophenylthiourea
5391-30-0 2-Bromophenylthiourea
Название продукта |
2-Bromophenylthiourea |
Синонимы |
Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
Молекулярная формула |
C7H7BrN2S |
Молекулярный вес |
231.1129 |
InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
Регистрационный номер CAS |
5391-30-0 |
Молекулярная структура |
|
Плотность |
1.728g/cm3 |
Точка кипения |
314.2°C at 760 mmHg |
Показатель преломления |
1.748 |
Температура вспышки |
143.8°C |
Символы опасности |
|
Риск коды |
R25:Toxic if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|