ChemNet > CAS > 940-64-7 (4-Methylphenoxy)acetic acid
940-64-7 (4-Methylphenoxy)acetic acid
| Nome del prodotto |
(4-Methylphenoxy)acetic acid |
| Sinonimi |
4-Methylphenoxyacetic acid; (p-Tolyloxy)-acetic acid; (4-methylphenoxy)acetate |
| Formula molecolare |
C9H9O3 |
| Peso Molecolare |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-2-4-8(5-3-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| Numero CAS |
940-64-7 |
| EINECS |
213-374-7 |
| Struttura molecolare |
|
| Punto di fusione |
141-142℃ |
| Punto di ebollizione |
297.2°C at 760 mmHg |
| Punto d'infiammabilità |
120°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
