ChemNet > CAS > 940-64-7 (4-Methylphenoxy)acetic acid
940-64-7 (4-Methylphenoxy)acetic acid
Naam product |
(4-Methylphenoxy)acetic acid |
Synoniemen |
4-Methylphenoxyacetic acid; (p-Tolyloxy)-acetic acid; (4-methylphenoxy)acetate |
MF |
C9H9O3 |
Molecuulgewicht |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-7-2-4-8(5-3-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
CAS-nummer |
940-64-7 |
EINECS |
213-374-7 |
Moleculaire Structuur |
|
Smeltpunt |
141-142℃ |
Kookpunt |
297.2°C at 760 mmHg |
Vlampunt |
120°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|