ChemNet > CAS > 1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
상품명칭 |
2-Bromo-2',5'-dimethoxyacetophenone |
영문 이름 |
2-Bromo-2',5'-dimethoxyacetophenone; bromomethyl 2,5-dimethoxyphenyl ketone; 2-Bromo-2,5-dimethoxyacetophenone; 2-bromo-1-(2,5-dimethoxyphenyl)ethanone |
분자식 |
C10H11BrO3 |
분자량 |
259.0965 |
InChI |
InChI=1/C10H11BrO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5H,6H2,1-2H3 |
cas번호 |
1204-21-3 |
EC번호 |
214-873-2 |
분자 구조 |
|
밀도 |
1.422g/cm3 |
녹는 점 |
83-88℃ |
비등점 |
323.1°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
149.2°C |
증기압 |
0.000268mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|