ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
상품명칭 |
2,3,6-trifluoroacetophenone |
영문 이름 |
2,3,6-trifluoroacetophenone; 2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
분자식 |
C8H5F3O |
분자량 |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
cas번호 |
208173-22-2 |
분자 구조 |
|
밀도 |
1.303g/cm3 |
비등점 |
187.2°C at 760 mmHg |
굴절 지수 |
1.455 |
인화점 |
65°C |
증기압 |
0.637mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|