ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
Ürün Adı |
2,3,6-trifluoroacetophenone |
Eş anlamlı |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
Moleküler Formülü |
C8H5F3O |
Molekül Ağırlığı |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
CAS kayıt numarası |
208173-22-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.303g/cm3 |
Kaynama noktası |
187.2°C at 760 mmHg |
Kırılma indisi |
1.455 |
Alevlenme noktası |
65°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|