ChemNet > CAS > 4771-50-0 7-methylindole 3-carboxaldehyde
4771-50-0 7-methylindole 3-carboxaldehyde
상품명칭 |
7-methylindole 3-carboxaldehyde |
별명 |
7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
분자식 |
C10H9NO |
분자량 |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
cas번호 |
4771-50-0 |
분자 구조 |
|
밀도 |
1.226g/cm3 |
비등점 |
341°C at 760 mmHg |
굴절 지수 |
1.698 |
인화점 |
168°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|