ChemNet > CAS > 6972-71-0 4,5-Dimethyl-2-nitroaniline
6972-71-0 4,5-Dimethyl-2-nitroaniline
상품명칭 |
4,5-Dimethyl-2-nitroaniline |
별명 |
2-Nitro-4,5-Dimethyl Aniline; 6-Nitro-3,4-xylidine |
분자식 |
C8H10N2O2 |
분자량 |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
cas번호 |
6972-71-0 |
EC번호 |
230-211-5 |
분자 구조 |
|
밀도 |
1.22g/cm3 |
녹는 점 |
138-143℃ |
비등점 |
335.7°C at 760 mmHg |
굴절 지수 |
1.601 |
인화점 |
156.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|