ChemNet > CAS > 79676-56-5 2-(Difluoromethylthio)benzoic acid
79676-56-5 2-(Difluoromethylthio)benzoic acid
상품명칭 |
2-(Difluoromethylthio)benzoic acid |
영문 이름 |
2-(Difluoromethylthio)benzoic acid;2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
분자식 |
C8H5ClF2OS |
분자량 |
222.6395 |
InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
cas번호 |
79676-56-5 |
분자 구조 |
|
밀도 |
1.42g/cm3 |
비등점 |
236.2°C at 760 mmHg |
굴절 지수 |
1.541 |
인화점 |
96.6°C |
증기압 |
0.0481mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|