ChemNet > CAS > 836-41-9 N-(4-Methoxybenzylidene)aniline
836-41-9 N-(4-Methoxybenzylidene)aniline
상품명칭 |
N-(4-Methoxybenzylidene)aniline |
영문 이름 |
N-(4-Methoxybenzylidene)aniline; p-Anisaldehyde anil~N-(4-Methoxybenzal)aniline; N-[(E)-(4-methoxyphenyl)methylidene]aniline |
분자식 |
C14H13NO |
분자량 |
211.2591 |
InChI |
InChI=1/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3 |
cas번호 |
836-41-9 |
EC번호 |
212-647-8 |
분자 구조 |
|
밀도 |
1g/cm3 |
비등점 |
339.002°C at 760 mmHg |
굴절 지수 |
1.539 |
인화점 |
129.557°C |
증기압 |
0mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|