ChemNet > CAS > 64287-19-0 4-Fluoro-3-methoxyacetophenone
64287-19-0 4-Fluoro-3-methoxyacetophenone
Nama produk |
4-Fluoro-3-methoxyacetophenone |
Sinonim |
1-(4-Fluoro-3-methoxyphenyl)ethanone; Ethanone, 2-amino-1-(2,4-difluorophenyl)-; 4'-Fluoro-3'-methoxyacetophenone |
MF |
C8H7F2NO |
Berat Molekul |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3H,4,11H2 |
CAS NO |
64287-19-0 |
Struktur Molekul |
|
Kepadatan |
1.286g/cm3 |
Titik didih |
255.9°C at 760 mmHg |
Indeks bias |
1.51 |
Titik nyala |
108.6°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|