ChemNet > CAS > 10075-62-4 1,4-Dimethoxynaphthalene
10075-62-4 1,4-Dimethoxynaphthalene
Naam product |
1,4-Dimethoxynaphthalene |
Engelse naam |
1,4-Dimethoxynaphthalene; |
MF |
C12H12O2 |
Molecuulgewicht |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-13-11-7-8-12(14-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
CAS-nummer |
10075-62-4 |
EINECS |
233-209-2 |
Moleculaire Structuur |
|
Dichtheid |
1.097g/cm3 |
Kookpunt |
317.6°C at 760 mmHg |
Brekingsindex |
1.584 |
Vlampunt |
134.3°C |
Dampdruk |
0.000708mmHg at 25°C |
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|