ChemNet > CAS > 10075-62-4 1,4-Dimethoxynaphthalene
10075-62-4 1,4-Dimethoxynaphthalene
| Nome do produto |
1,4-Dimethoxynaphthalene |
| Fórmula molecular |
C12H12O2 |
| Peso Molecular |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-13-11-7-8-12(14-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| CAS Registry Number |
10075-62-4 |
| EINECS |
233-209-2 |
| Estrutura Molecular |
|
| Densidade |
1.097g/cm3 |
| Ponto de ebulição |
317.6°C at 760 mmHg |
| índice de refração |
1.584 |
| O ponto de inflamação |
134.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
