ChemNet > CAS > 6164-79-0 Methyl pyrazine-2-carboxylate
6164-79-0 Methyl pyrazine-2-carboxylate
| Naam product |
Methyl pyrazine-2-carboxylate |
| Synoniemen |
Methyl pyrazinecarboxylate; Pyrazinecarboxylic acid methyl ester; Methyl pyrazinoate; Pyrazinecarboxylic acid methyl ester; Methyl 2-Pyrazinecarboxylate |
| MF |
C6H6N2O2 |
| Molecuulgewicht |
138.124 |
| InChI |
InChI=1/C6H6N2O2/c1-10-6(9)5-4-7-2-3-8-5/h2-4H,1H3 |
| CAS-nummer |
6164-79-0 |
| EINECS |
228-198-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.213g/cm3 |
| Smeltpunt |
57-59℃ |
| Kookpunt |
220.4°C at 760 mmHg |
| Brekingsindex |
1.513 |
| Vlampunt |
87.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
