ChemNet > CAS > 6164-79-0 Methyl pyrazine-2-carboxylate
6164-79-0 Methyl pyrazine-2-carboxylate
Naam product |
Methyl pyrazine-2-carboxylate |
Synoniemen |
Methyl pyrazinecarboxylate; Pyrazinecarboxylic acid methyl ester; Methyl pyrazinoate; Pyrazinecarboxylic acid methyl ester; Methyl 2-Pyrazinecarboxylate |
MF |
C6H6N2O2 |
Molecuulgewicht |
138.124 |
InChI |
InChI=1/C6H6N2O2/c1-10-6(9)5-4-7-2-3-8-5/h2-4H,1H3 |
CAS-nummer |
6164-79-0 |
EINECS |
228-198-6 |
Moleculaire Structuur |
|
Dichtheid |
1.213g/cm3 |
Smeltpunt |
57-59℃ |
Kookpunt |
220.4°C at 760 mmHg |
Brekingsindex |
1.513 |
Vlampunt |
87.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|