ChemNet > CAS > 6164-79-0 Methyl pyrazine-2-carboxylate
6164-79-0 Methyl pyrazine-2-carboxylate
| produktnavn |
Methyl pyrazine-2-carboxylate |
| Synonymer |
Methyl pyrazinecarboxylate; Pyrazinecarboxylic acid methyl ester; Methyl pyrazinoate; Pyrazinecarboxylic acid methyl ester; Methyl 2-Pyrazinecarboxylate |
| Molekylær Formel |
C6H6N2O2 |
| Molekylvekt |
138.124 |
| InChI |
InChI=1/C6H6N2O2/c1-10-6(9)5-4-7-2-3-8-5/h2-4H,1H3 |
| CAS-nummer |
6164-79-0 |
| EINECS |
228-198-6 |
| Molecular Structure |
|
| Tetthet |
1.213g/cm3 |
| Smeltepunkt |
57-59℃ |
| Kokepunkt |
220.4°C at 760 mmHg |
| Brytningsindeks |
1.513 |
| Flammepunktet |
87.1°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
