ChemNet > CAS > 132546-81-7 methyl 6-morpholinonicotinate
132546-81-7 methyl 6-morpholinonicotinate
| produktnavn |
methyl 6-morpholinonicotinate |
| Engelsk navn |
methyl 6-morpholinonicotinate;methyl 6-morpholin-4-ylpyridine-3-carboxylate |
| Molekylær Formel |
C11H14N2O3 |
| Molekylvekt |
222.2405 |
| InChI |
InChI=1/C11H14N2O3/c1-15-11(14)9-2-3-10(12-8-9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3 |
| CAS-nummer |
132546-81-7 |
| Molecular Structure |
|
| Tetthet |
1.208g/cm3 |
| Smeltepunkt |
109℃ |
| Kokepunkt |
383.6°C at 760 mmHg |
| Brytningsindeks |
1.542 |
| Flammepunktet |
185.8°C |
| Damptrykk |
4.36E-06mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|