ChemNet > CAS > 132546-81-7 methyl 6-morpholinonicotinate
132546-81-7 methyl 6-morpholinonicotinate
Nazwa produktu: |
methyl 6-morpholinonicotinate |
Synonimy |
methyl 6-morpholin-4-ylpyridine-3-carboxylate |
MF |
C11H14N2O3 |
Masie cząsteczkowej |
222.2405 |
InChI |
InChI=1/C11H14N2O3/c1-15-11(14)9-2-3-10(12-8-9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3 |
Nr CAS |
132546-81-7 |
Struktury molekularnej |
|
Gęstość |
1.208g/cm3 |
Temperatura topnienia |
109℃ |
Temperatura wrzenia |
383.6°C at 760 mmHg |
Współczynnik załamania |
1.542 |
Temperatura zapłonu |
185.8°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|