ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
| produktnavn |
4-(difluoromethoxy)nitrobenzene |
| Engelsk navn |
4-(difluoromethoxy)nitrobenzene; 1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| Molekylær Formel |
C7H5F2NO2 |
| Molekylvekt |
173.1169 |
| InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| CAS-nummer |
1544-86-1 |
| Molecular Structure |
|
| Tetthet |
1.339g/cm3 |
| Smeltepunkt |
33-110℃ |
| Kokepunkt |
240.7°C at 760 mmHg |
| Brytningsindeks |
1.5 |
| Flammepunktet |
111.9°C |
| Damptrykk |
0.0578mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|