ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
اسم المنتج |
4-(difluoromethoxy)nitrobenzene |
الاسم المستعار |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
الصيغة الجزيئية |
C7H5F2NO2 |
الوزن الجزيئي الغرامي |
173.1169 |
InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
إستراتيجية المساعدة القطرية |
1544-86-1 |
بنية جزيئية |
|
كثافة |
1.339g/cm3 |
درجة الإنصهار |
33-110℃ |
نقطة الغليان |
240.7°C at 760 mmHg |
معامل الإنكسار |
1.5 |
نقطة الوميض |
111.9°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|