621-63-6 2,2-diethoxyethanol
produktnavn |
2,2-diethoxyethanol |
Engelsk navn |
2,2-diethoxyethanol; Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
Molekylær Formel |
C6H14O3 |
Molekylvekt |
134.1736 |
InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
CAS-nummer |
621-63-6 |
EINECS |
210-697-5 |
Molecular Structure |
|
Tetthet |
0.97g/cm3 |
Kokepunkt |
167°C at 760 mmHg |
Brytningsindeks |
1.418 |
Flammepunktet |
68.4°C |
Damptrykk |
0.574mmHg at 25°C |
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|