ChemNet > CAS > 130560-97-3 3-chloro-4-fluorothiobenzamide
130560-97-3 3-chloro-4-fluorothiobenzamide
Nazwa produktu: |
3-chloro-4-fluorothiobenzamide |
Angielska nazwa |
3-chloro-4-fluorothiobenzamide; 3-Chloro-4-fluorobenzene-1-carbothioamide; 3-chloro-4-fluorobenzenecarbothioamide |
MF |
C7H5ClFNS |
Masie cząsteczkowej |
189.6377 |
InChI |
InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
Nr CAS |
130560-97-3 |
Struktury molekularnej |
|
Gęstość |
1.434g/cm3 |
Temperatura topnienia |
129-130℃ |
Temperatura wrzenia |
285.5°C at 760 mmHg |
Współczynnik załamania |
1.635 |
Temperatura zapłonu |
126.5°C |
Ciśnienie pary |
0.00279mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|