ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
Nazwa produktu: |
Methyl 2-methoxypropionate |
Synonimy |
2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
MF |
C5H10O3 |
Masie cząsteczkowej |
118.1311 |
InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
Nr CAS |
17639-76-8 |
EINECS |
241-622-4 |
Struktury molekularnej |
|
Gęstość |
0.973g/cm3 |
Temperatura wrzenia |
136.2°C at 760 mmHg |
Współczynnik załamania |
1.389 |
Temperatura zapłonu |
40.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|