ChemNet > CAS > 4079-52-1 2-Methoxyacetophenone
4079-52-1 2-Methoxyacetophenone
| Nazwa produktu: |
2-Methoxyacetophenone |
| Synonimy |
2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
| MF |
C9H10O2 |
| Masie cząsteczkowej |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| Nr CAS |
4079-52-1 |
| EINECS |
223-802-4 |
| Struktury molekularnej |
|
| Gęstość |
1.035g/cm3 |
| Temperatura topnienia |
7-8℃ |
| Temperatura wrzenia |
245°C at 760 mmHg |
| Współczynnik załamania |
1.504 |
| Temperatura zapłonu |
92.8°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
