ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
Nazwa produktu: |
2,5-Dibromo-3,4-dinitrothiophene |
Synonimy |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
MF |
C4Br2N2O4S |
Masie cząsteczkowej |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
Nr CAS |
52431-30-8 |
Struktury molekularnej |
|
Gęstość |
2.459g/cm3 |
Temperatura wrzenia |
341.2°C at 760 mmHg |
Współczynnik załamania |
1.716 |
Temperatura zapłonu |
160.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|