ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
اسم المنتج |
2,5-Dibromo-3,4-dinitrothiophene |
الاسم المستعار |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
الصيغة الجزيئية |
C4Br2N2O4S |
الوزن الجزيئي الغرامي |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
إستراتيجية المساعدة القطرية |
52431-30-8 |
بنية جزيئية |
|
كثافة |
2.459g/cm3 |
نقطة الغليان |
341.2°C at 760 mmHg |
معامل الإنكسار |
1.716 |
نقطة الوميض |
160.2°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|