ChemNet > CAS > 17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
اسم المنتج |
ethyl 4-hydroxycyclohexanecarboxylate |
الاسم بالانجليزية |
ethyl 4-hydroxycyclohexanecarboxylate; Ethyl 4-hydroxycyclohexanecarboxylate,mixture of cis and trans; Ethyl 4-hydroxycyclohexane carboxylate |
الصيغة الجزيئية |
C9H16O3 |
الوزن الجزيئي الغرامي |
172.2215 |
InChI |
InChI=1/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
إستراتيجية المساعدة القطرية |
17159-80-7 |
المفوضية الأوروبية رقم |
241-215-1 |
بنية جزيئية |
|
كثافة |
1.093g/cm3 |
نقطة الغليان |
251.4°C at 760 mmHg |
معامل الإنكسار |
1.481 |
نقطة الوميض |
100.2°C |
ضغط البخار |
0.00322mmHg at 25°C |
|