ChemNet > CAS > 20595-44-2 2,3-Dichlorocinnamic acid
20595-44-2 2,3-Dichlorocinnamic acid
اسم المنتج |
2,3-Dichlorocinnamic acid |
الاسم المستعار |
(2E)-3-(2,3-dichlorophenyl)prop-2-enoate; (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
الصيغة الجزيئية |
C9H6Cl2O2 |
الوزن الجزيئي الغرامي |
217.0487 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+ |
إستراتيجية المساعدة القطرية |
20595-44-2 |
بنية جزيئية |
|
كثافة |
1.457g/cm3 |
نقطة الغليان |
363°C at 760 mmHg |
معامل الإنكسار |
1.637 |
نقطة الوميض |
173.3°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|