ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
نام محصول |
1-(2,6-Dimethylphenyl)-thiourea |
نام انگلیسی |
1-(2,6-Dimethylphenyl)-thiourea; 2,6-Dimethylphenylthiourea |
میدان مغناطیسی |
C9H12N2S |
وزن مولکولی |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
شماره سیایاس |
6396-76-5 |
تعداد کمیسیون اروپایی |
229-005-8 |
ساختار مولکولی |
|
تراکم |
1.2g/cm3 |
نقطه غلیان |
284.4°C at 760 mmHg |
ضریب شکست |
1.674 |
نقطه اشتعال |
125.8°C |
فشار بخار |
0.00298mmHg at 25°C |
کدهای خطر |
R25:Toxic if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|