Details for 2-(4-methylthiazol-5-yl)ethyl propanoate

2-(4-methylthiazol-5-yl)ethyl propanoate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
324742-96-3 |
| EC NO: |
|
| Molecular Formula: |
C9H13NO2S |
| Molecular Weight: |
199.27 |
| Specification: |
|
| InChI: |
InChI=1/C9H13NO2S/c1-3-9(11)12-5-4-8-7(2)10-6-13-8/h6H,3-5H2,1-2H3 |
| Packing: |
25kg per drum or 50 kg per drum or according to customer requirements |
| Uses: |
Daily flavor |
| Synonyms: |
2-(4-Methyl-1,3-thiazol-5-yl)ethyl propionate;5-thiazoleethanol, 4-methyl-, propanoate (ester);Sulfurol propionate;4-Methyl-5-ethylol thiazole propionate;4-Methyl-5-thiazoleethanol propionate; |
| Molecular Structure: |
 |
if you are sourcing 2-(4-methylthiazol-5-yl)ethyl propanoate from China ,just feel free to inquire