Details for 2-Methyl-1-butanethiol
2-Methyl-1-butanethiol
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
1878-18-8 |
| EC NO: |
217-515-3 |
| Molecular Formula: |
C5H12S |
| Molecular Weight: |
104.2138 |
| Specification: |
|
| InChI: |
InChI=1/C5H12S/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3/t5-/m0/s1 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to yellow liquid |
Green Onion Flavor |
Meat Products, Seasonings |
|
| Synonyms: |
2-Methylbutyl mercaptan;2-methylbutane-1-thiol;(2R)-2-methylbutane-1-thiol;(2S)-2-methylbutane-1-thiol; |
| Molecular Structure: |
 |
if you are sourcing 2-Methyl-1-butanethiol from China ,just feel free to inquire
CN
China Suppliers > tzrunlong > 
Search Product