Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
513-86-0 |
EC NO: |
208-174-1 |
Molecular Formula: |
C4H8O2 |
Molecular Weight: |
88.1051 |
Specification: |
|
InChI: |
InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
Product description:
Appearance |
Odor |
Application |
Achromatic to light yellow liquid (monomer), white crystalline powder (dimer) |
Pleasant Cream Aroma |
Essence of Milk Aroma, Meat Aroma, Fruits |
|
Synonyms: |
3-Hydroxy-2-butanone;acetoin, mixture of monomer and dimer;Acetoin (3-Hydroxy-2-butanone);1-acetylethanol;Acetoin;3-hydroxybutan-2-one;(3R)-3-hydroxybutan-2-one;(3S)-3-hydroxybutan-2-one;Acetoion;Acetion; |
Molecular Structure: |
 |