ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
| Produkt-Name |
2-Methoxybiphenyl |
| Synonyme |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Molekulare Formel |
C13H12O |
| Molecular Weight |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS Registry Number |
86-26-0 |
| EINECS |
201-659-9 |
| Molecular Structure |
|
| Dichte |
1.03g/cm3 |
| Schmelzpunkt |
30-33℃ |
| Siedepunkt |
274°C at 760 mmHg |
| Brechungsindex |
1.556 |
| Flammpunkt |
101.3°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R33:Danger of cummulative effects.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
