10502-44-0 4-methoxymandelic acid
product Name |
4-methoxymandelic acid |
CAS No |
10502-44-0 |
Synonyms |
alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
Molecular Formula |
C9H10O4 |
Molecular Weight |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
EINECS |
234-031-8 |
Molecular Structure |
|
Density |
1.309g/cm3 |
Melting point |
108-111℃ |
Boiling point |
370.4°C at 760 mmHg |
Refractive index |
1.569 |
Flash point |
152.6°C |
Vapour Pressur |
3.86E-06mmHg at 25°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|