ChemNet > CAS > 10502-44-0 4-methoxymandelic acid
10502-44-0 4-methoxymandelic acid
| Ürün Adı |
4-methoxymandelic acid |
| Eş anlamlı |
alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
| Moleküler Formülü |
C9H10O4 |
| Molekül Ağırlığı |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
| CAS kayıt numarası |
10502-44-0 |
| EINECS |
234-031-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.309g/cm3 |
| Ergime noktası |
108-111℃ |
| Kaynama noktası |
370.4°C at 760 mmHg |
| Kırılma indisi |
1.569 |
| Alevlenme noktası |
152.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
