10502-44-0 4-methoxymandelic acid
نام محصول |
4-methoxymandelic acid |
نام انگلیسی |
4-methoxymandelic acid; alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
میدان مغناطیسی |
C9H10O4 |
وزن مولکولی |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
شماره سیایاس |
10502-44-0 |
تعداد کمیسیون اروپایی |
234-031-8 |
ساختار مولکولی |
|
تراکم |
1.309g/cm3 |
نقطه ذوب |
108-111℃ |
نقطه غلیان |
370.4°C at 760 mmHg |
ضریب شکست |
1.569 |
نقطه اشتعال |
152.6°C |
فشار بخار |
3.86E-06mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|