ChemNet > CAS > 10502-44-0 4-methoxymandelic acid
10502-44-0 4-methoxymandelic acid
Название продукта |
4-methoxymandelic acid |
Синонимы |
alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
Молекулярная формула |
C9H10O4 |
Молекулярный вес |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
Регистрационный номер CAS |
10502-44-0 |
EINECS |
234-031-8 |
Молекулярная структура |
|
Плотность |
1.309g/cm3 |
Температура плавления |
108-111℃ |
Точка кипения |
370.4°C at 760 mmHg |
Показатель преломления |
1.569 |
Температура вспышки |
152.6°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|