ChemNet > CAS > 14360-50-0 n-Amyl 2-furyl ketone
14360-50-0 n-Amyl 2-furyl ketone
| product Name |
n-Amyl 2-furyl ketone |
| Synonyms |
2-Furyl Pentyl Ketone; 2-Hexanoylfuran; n-Amyl 2-furyl ketone~2-Furyl n-pentyl ketone; 1-(furan-2-yl)hexan-1-one; 1-furan-2-ylhexan-2-one |
| Molecular Formula |
C10H14O2 |
| Molecular Weight |
166.217 |
| InChI |
InChI=1/C10H14O2/c1-2-3-5-9(11)8-10-6-4-7-12-10/h4,6-7H,2-3,5,8H2,1H3 |
| CAS Registry Number |
14360-50-0 |
| EINECS |
238-333-0 |
| Molecular Structure |
|
| Density |
0.988g/cm3 |
| Boiling point |
228.3°C at 760 mmHg |
| Refractive index |
1.466 |
| Flash point |
97.4°C |
| Vapour Pressur |
0.0741mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
